CAS 41189-09-7 is the registry number for N'-(3,3-Dimethyl-5-oxocyclohexylidene)-4-methylbenzenesulfonohydrazide, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
N-[(Z)-(3,3-dimethyl-5-oxocyclohexylidene)amino]-4-methylbenzenesulfonamide (CAS 41189-09-7) is a chemical compound with the molecular formula C15H20N2O3S and a molecular weight of 308.4 g/mol. IUPAC name: N-[(Z)-(3,3-dimethyl-5-oxocyclohexylidene)amino]-4-methylbenzenesulfonamide. InChIKey: HZAPVISLNYOUOE-FOWTUZBSSA-N.
| Molecular formula | C15H20N2O3S |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | N-[(Z)-(3,3-dimethyl-5-oxocyclohexylidene)amino]-4-methylbenzenesulfonamide |
| InChIKey | HZAPVISLNYOUOE-FOWTUZBSSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N/N=C/2\CC(=O)CC(C2)(C)C |
Computed by PubChem (NCBI)