Products 41197-29-9

CAS 41197-29-9 is the registry number for Dichloromethanesulfonyl Chloride. Offered by: TRC. Available pack sizes: 500mg, 5g.

Structural formula: {0} (CAS {1})

Dichloromethanesulfonyl chloride (CAS 41197-29-9) is a chemical compound with the molecular formula CHCl3O2S and a molecular weight of 183.4 g/mol. IUPAC name: dichloromethanesulfonyl chloride. InChIKey: ZTCPYHGKJGSSPD-UHFFFAOYSA-N.

Identity
Molecular formulaCHCl3O2S
Molecular weight183.4 g/mol
IUPAC namedichloromethanesulfonyl chloride
InChIKeyZTCPYHGKJGSSPD-UHFFFAOYSA-N
SMILESC(S(=O)(=O)Cl)(Cl)Cl

Computed by PubChem (NCBI)