CAS 412048-44-3 is the registry number for 4-Bromo-1-(triisopropylsilyl)-1H-indole, 97% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g.
(4-bromoindol-1-yl)-tri(propan-2-yl)silane (CAS 412048-44-3) is a chemical compound with the molecular formula C17H26BrNSi and a molecular weight of 352.4 g/mol. IUPAC name: (4-bromoindol-1-yl)-tri(propan-2-yl)silane. InChIKey: ZXHMUQVMGJYGAV-UHFFFAOYSA-N.
| Molecular formula | C17H26BrNSi |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | (4-bromoindol-1-yl)-tri(propan-2-yl)silane |
| InChIKey | ZXHMUQVMGJYGAV-UHFFFAOYSA-N |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)N1C=CC2=C1C=CC=C2Br |
Computed by PubChem (NCBI)