CAS 412308-26-0 appears in our catalog under these names: Biotin Impurity C, Potassium 5-(3,4-diaminothiophen-2-yl)pentanoate, 97%, Biotin Impurity 3(Biotin EP Impurity C), Biotin Impurity 33 DiHCl. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Potassium 5-(3,4-diaminothiophen-2-yl)pentanoate (CAS 412308-26-0) is a chemical compound with the molecular formula C9H13KN2O2S and a molecular weight of 252.38 g/mol. IUPAC name: potassium 5-(3,4-diaminothiophen-2-yl)pentanoate. InChIKey: QBOWQZUVUGIIKN-UHFFFAOYSA-M.
| Molecular formula | C9H13KN2O2S |
|---|---|
| Molecular weight | 252.38 g/mol |
| IUPAC name | potassium 5-(3,4-diaminothiophen-2-yl)pentanoate |
| InChIKey | QBOWQZUVUGIIKN-UHFFFAOYSA-M |
| SMILES | C1=C(C(=C(S1)CCCCC(=O)[O-])N)N.[K+] |
Computed by PubChem (NCBI)