Products 412334-56-6

CAS 412334-56-6 is the registry number for Terazosin Impurity 19. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

[(2R)-oxolan-2-yl]-piperazin-1-ylmethanone (CAS 412334-56-6) is a chemical compound with the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. IUPAC name: [(2R)-oxolan-2-yl]-piperazin-1-ylmethanone. InChIKey: UKESBLFBQANJHH-MRVPVSSYSA-N.

Identity
Molecular formulaC9H16N2O2
Molecular weight184.24 g/mol
IUPAC name[(2R)-oxolan-2-yl]-piperazin-1-ylmethanone
InChIKeyUKESBLFBQANJHH-MRVPVSSYSA-N
SMILESC1C[C@@H](OC1)C(=O)N2CCNCC2

Computed by PubChem (NCBI)