CAS 412334-56-6 is the registry number for Terazosin Impurity 19. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
[(2R)-oxolan-2-yl]-piperazin-1-ylmethanone (CAS 412334-56-6) is a chemical compound with the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. IUPAC name: [(2R)-oxolan-2-yl]-piperazin-1-ylmethanone. InChIKey: UKESBLFBQANJHH-MRVPVSSYSA-N.
| Molecular formula | C9H16N2O2 |
|---|---|
| Molecular weight | 184.24 g/mol |
| IUPAC name | [(2R)-oxolan-2-yl]-piperazin-1-ylmethanone |
| InChIKey | UKESBLFBQANJHH-MRVPVSSYSA-N |
| SMILES | C1C[C@@H](OC1)C(=O)N2CCNCC2 |
Computed by PubChem (NCBI)