CAS 412343-21-6 appears in our catalog under these names: 2-Chloro-4-[(tert-butyldimethylsilyl)oxy]phenylboronic acid, 98%, (4-((tert-Butyldimethylsilyl)oxy)-2-chlorophenyl)boronic acid, 98%, 2-Chloro-4-[(tert-butyldimethylsilyl)oxy]phenylboronic acid, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 25g, 10g, 100g, 5g.
[4-[tert-butyl(dimethyl)silyl]oxy-2-chlorophenyl]boronic acid (CAS 412343-21-6) is a chemical compound with the molecular formula C12H20BClO3Si and a molecular weight of 286.63 g/mol. IUPAC name: [4-[tert-butyl(dimethyl)silyl]oxy-2-chlorophenyl]boronic acid. InChIKey: KPSMCFBSUNQTHV-UHFFFAOYSA-N.
| Molecular formula | C12H20BClO3Si |
|---|---|
| Molecular weight | 286.63 g/mol |
| IUPAC name | [4-[tert-butyl(dimethyl)silyl]oxy-2-chlorophenyl]boronic acid |
| InChIKey | KPSMCFBSUNQTHV-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)O[Si](C)(C)C(C)(C)C)Cl)(O)O |
Computed by PubChem (NCBI)