Products 41255-23-6
CAS 41255-23-6 is the registry number for 2-([1,1'-Biphenyl]-4-yl)-3-hydroxy-4H-chromen-4-one, 97%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg.
3-hydroxy-2-(4-phenylphenyl)chromen-4-one (CAS 41255-23-6) is a chemical compound with the molecular formula C21H14O3 and a molecular weight of 314.3 g/mol. IUPAC name: 3-hydroxy-2-(4-phenylphenyl)chromen-4-one. InChIKey: GGZRQOVVDYPXHW-UHFFFAOYSA-N.
| Molecular formula | C21H14O3 |
|---|---|
| Molecular weight | 314.3 g/mol |
| IUPAC name | 3-hydroxy-2-(4-phenylphenyl)chromen-4-one |
| InChIKey | GGZRQOVVDYPXHW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=C(C(=O)C4=CC=CC=C4O3)O |
Computed by PubChem (NCBI)