Products 41261-24-9

CAS 41261-24-9 is the registry number for Tetramethylammonium 2,2,2-trifluoroacetate 95%. Offered by: Ambeed. Available pack sizes: 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

Tetramethylazanium;2,2,2-trifluoroacetate (CAS 41261-24-9) is a chemical compound with the molecular formula C6H12F3NO2 and a molecular weight of 187.16 g/mol. IUPAC name: tetramethylazanium;2,2,2-trifluoroacetate. InChIKey: LROATHSBUUYETB-UHFFFAOYSA-M.

Identity
Molecular formulaC6H12F3NO2
Molecular weight187.16 g/mol
IUPAC nametetramethylazanium;2,2,2-trifluoroacetate
InChIKeyLROATHSBUUYETB-UHFFFAOYSA-M
SMILESC[N+](C)(C)C.C(=O)(C(F)(F)F)[O-]

Computed by PubChem (NCBI)