CAS 41261-24-9 is the registry number for Tetramethylammonium 2,2,2-trifluoroacetate 95%. Offered by: Ambeed. Available pack sizes: 1g, 5g, 10g, 25g.
Tetramethylazanium;2,2,2-trifluoroacetate (CAS 41261-24-9) is a chemical compound with the molecular formula C6H12F3NO2 and a molecular weight of 187.16 g/mol. IUPAC name: tetramethylazanium;2,2,2-trifluoroacetate. InChIKey: LROATHSBUUYETB-UHFFFAOYSA-M.
| Molecular formula | C6H12F3NO2 |
|---|---|
| Molecular weight | 187.16 g/mol |
| IUPAC name | tetramethylazanium;2,2,2-trifluoroacetate |
| InChIKey | LROATHSBUUYETB-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)C.C(=O)(C(F)(F)F)[O-] |
Computed by PubChem (NCBI)