CAS 4128-73-8 appears in our catalog under these names: 4,4'-Bis(isocyanatophenyl)oxide, 4,4'-Oxybis(phenyl isocyanate). Offered by: TRC, Biosynth. Available pack sizes: 100mg, 250mg, 500mg, 1g.
1-isocyanato-4-(4-isocyanatophenoxy)benzene (CAS 4128-73-8) is a chemical compound with the molecular formula C14H8N2O3 and a molecular weight of 252.22 g/mol. IUPAC name: 1-isocyanato-4-(4-isocyanatophenoxy)benzene. InChIKey: KDLIYVDINLSKGR-UHFFFAOYSA-N.
| Molecular formula | C14H8N2O3 |
|---|---|
| Molecular weight | 252.22 g/mol |
| IUPAC name | 1-isocyanato-4-(4-isocyanatophenoxy)benzene |
| InChIKey | KDLIYVDINLSKGR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=C=O)OC2=CC=C(C=C2)N=C=O |
Computed by PubChem (NCBI)