CAS 41280-55-1 appears in our catalog under these names: 4-(2,6-Dimethylphenoxy)aniline, 98%, 4–(2,6–Dimethylphenoxy)aniline, 4-(2,6-Dimethylphenoxy)aniline 95%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 1g, 10g, 5g, 250mg, 25g.
4-(2,6-dimethylphenoxy)aniline (CAS 41280-55-1) is a chemical compound with the molecular formula C14H15NO and a molecular weight of 213.27 g/mol. IUPAC name: 4-(2,6-dimethylphenoxy)aniline. InChIKey: BPXYBTUWCJUAJH-UHFFFAOYSA-N.
| Molecular formula | C14H15NO |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | 4-(2,6-dimethylphenoxy)aniline |
| InChIKey | BPXYBTUWCJUAJH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)OC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)