CAS 412923-01-4 appears in our catalog under these names: 2-({((2-fluorophenyl)carbamoyl)methyl}sulfanyl)acetic acid, 95%, 2-({((2-Fluorophenyl)carbamoyl)methyl}sulfanyl)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-[2-(2-fluoroanilino)-2-oxoethyl]sulfanylacetic acid (CAS 412923-01-4) is a chemical compound with the molecular formula C10H10FNO3S and a molecular weight of 243.26 g/mol. IUPAC name: 2-[2-(2-fluoroanilino)-2-oxoethyl]sulfanylacetic acid. InChIKey: QTUAYANJBVLYAG-UHFFFAOYSA-N.
| Molecular formula | C10H10FNO3S |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | 2-[2-(2-fluoroanilino)-2-oxoethyl]sulfanylacetic acid |
| InChIKey | QTUAYANJBVLYAG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)CSCC(=O)O)F |
Computed by PubChem (NCBI)