CAS 4130-08-9 is the registry number for TRIACETOXYVINYLSILANE, TECH.. Offered by: Sigma-Aldrich. Available pack sizes: 250ML.
[diacetyloxy(ethenyl)silyl] acetate (CAS 4130-08-9) is a chemical compound with the molecular formula C8H12O6Si and a molecular weight of 232.26 g/mol. IUPAC name: [diacetyloxy(ethenyl)silyl] acetate. InChIKey: NOZAQBYNLKNDRT-UHFFFAOYSA-N.
| Molecular formula | C8H12O6Si |
|---|---|
| Molecular weight | 232.26 g/mol |
| IUPAC name | [diacetyloxy(ethenyl)silyl] acetate |
| InChIKey | NOZAQBYNLKNDRT-UHFFFAOYSA-N |
| SMILES | CC(=O)O[Si](C=C)(OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)