CAS 41382-23-4 appears in our catalog under these names: 5-Methoxy-2,3,3-trimethylindolenine, 98%, 5-Methoxy-2,3,3-trimethylindoline, 98%, 98%, 5-Methoxy-2,3,3-trimethylindoline, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g.
5-methoxy-2,3,3-trimethyl-1,2-dihydroindole (CAS 41382-23-4) is a chemical compound with the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. IUPAC name: 5-methoxy-2,3,3-trimethyl-1,2-dihydroindole. InChIKey: JPJCJVLMPPNLQB-UHFFFAOYSA-N.
| Molecular formula | C12H17NO |
|---|---|
| Molecular weight | 191.27 g/mol |
| IUPAC name | 5-methoxy-2,3,3-trimethyl-1,2-dihydroindole |
| InChIKey | JPJCJVLMPPNLQB-UHFFFAOYSA-N |
| SMILES | CC1C(C2=C(N1)C=CC(=C2)OC)(C)C |
Computed by PubChem (NCBI)