CAS 4142-85-2 is the registry number for Bis(trichlorosilyl)methane, 97%, 97%. Offered by: Chemat. Available pack sizes: 5g, 25g, 100g.
Trichloro(trichlorosilylmethyl)silane (CAS 4142-85-2) is a chemical compound with the molecular formula CH2Cl6Si2 and a molecular weight of 282.9 g/mol. IUPAC name: trichloro(trichlorosilylmethyl)silane. InChIKey: ABDDAHLAEXNYRC-UHFFFAOYSA-N.
| Molecular formula | CH2Cl6Si2 |
|---|---|
| Molecular weight | 282.9 g/mol |
| IUPAC name | trichloro(trichlorosilylmethyl)silane |
| InChIKey | ABDDAHLAEXNYRC-UHFFFAOYSA-N |
| SMILES | C([Si](Cl)(Cl)Cl)[Si](Cl)(Cl)Cl |
Computed by PubChem (NCBI)