Products 41450-33-3
CAS 41450-33-3 is the registry number for Ethyl 2-(2-amino-5-nitrophenyl)-4-methylthiazole-5-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 2-(2-amino-5-nitrophenyl)-4-methyl-1,3-thiazole-5-carboxylate (CAS 41450-33-3) is a chemical compound with the molecular formula C13H13N3O4S and a molecular weight of 307.33 g/mol. IUPAC name: ethyl 2-(2-amino-5-nitrophenyl)-4-methyl-1,3-thiazole-5-carboxylate. InChIKey: ASHVHIIHZOANMU-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O4S |
|---|---|
| Molecular weight | 307.33 g/mol |
| IUPAC name | ethyl 2-(2-amino-5-nitrophenyl)-4-methyl-1,3-thiazole-5-carboxylate |
| InChIKey | ASHVHIIHZOANMU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)C2=C(C=CC(=C2)[N+](=O)[O-])N)C |
Computed by PubChem (NCBI)