CAS 4147-13-1 appears in our catalog under these names: Estradiol Benzoate EP Impurity C, Estradiol Benzoate Impurity 3 (Estradiol Benzoate EP Impurity C), Estra-1,3,5(10)-triene-3,17beta-diyl Dibenzoate (Estradiol 3,17-Dibenzoate), Estradiol EP Impurity C, ESTRADIOL DIBENZOATE. Offered by: Chemat Brand, Hubei YoungXin, Mikromol, Sigma-Aldrich. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 4x25mg.
[(8R,9S,13S,14S,17S)-3-benzoyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] benzoate (CAS 4147-13-1) is a chemical compound with the molecular formula C32H32O4 and a molecular weight of 480.6 g/mol. IUPAC name: [(8R,9S,13S,14S,17S)-3-benzoyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] benzoate. InChIKey: QSEBTTYLHXQXSF-CAHAWPIUSA-N.
| Molecular formula | C32H32O4 |
|---|---|
| Molecular weight | 480.6 g/mol |
| IUPAC name | [(8R,9S,13S,14S,17S)-3-benzoyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] benzoate |
| InChIKey | QSEBTTYLHXQXSF-CAHAWPIUSA-N |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2OC(=O)C4=CC=CC=C4)CCC5=C3C=CC(=C5)OC(=O)C6=CC=CC=C6 |
Computed by PubChem (NCBI)