Products 414905-09-2
CAS 414905-09-2 is the registry number for Hdm2 E3 ligase inhibitor 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
3,3,3-trifluoro-N-(4-sulfamoylphenyl)-2-(trifluoromethyl)propanamide (CAS 414905-09-2) is a chemical compound with the molecular formula C10H8F6N2O3S and a molecular weight of 350.24 g/mol. IUPAC name: 3,3,3-trifluoro-N-(4-sulfamoylphenyl)-2-(trifluoromethyl)propanamide. InChIKey: SKFRRPUNXSXVKN-UHFFFAOYSA-N.
| Molecular formula | C10H8F6N2O3S |
|---|---|
| Molecular weight | 350.24 g/mol |
| IUPAC name | 3,3,3-trifluoro-N-(4-sulfamoylphenyl)-2-(trifluoromethyl)propanamide |
| InChIKey | SKFRRPUNXSXVKN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)C(C(F)(F)F)C(F)(F)F)S(=O)(=O)N |
Computed by PubChem (NCBI)