CAS 414910-08-0 is the registry number for (S)-1-(3,5-Bis(trifluoromethyl)phenyl)-N-methylethan-1-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-N-methylethanamine;hydrochloride (CAS 414910-08-0) is a chemical compound with the molecular formula C11H12ClF6N and a molecular weight of 307.66 g/mol. IUPAC name: (1S)-1-[3,5-bis(trifluoromethyl)phenyl]-N-methylethanamine;hydrochloride. InChIKey: IPOAQLGRQPKMAR-RGMNGODLSA-N.
| Molecular formula | C11H12ClF6N |
|---|---|
| Molecular weight | 307.66 g/mol |
| IUPAC name | (1S)-1-[3,5-bis(trifluoromethyl)phenyl]-N-methylethanamine;hydrochloride |
| InChIKey | IPOAQLGRQPKMAR-RGMNGODLSA-N |
| SMILES | C[C@@H](C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)NC.Cl |
Computed by PubChem (NCBI)