CAS 414910-13-7 is the registry number for (R)-2-(4-Fluoro-2-methylphenyl)piperidin-4-one (S)-2-hydroxy-2-phenylacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-(4-fluoro-2-methylphenyl)piperidin-4-one;(2S)-2-hydroxy-2-phenylacetic acid (CAS 414910-13-7) is a chemical compound with the molecular formula C20H22FNO4 and a molecular weight of 359.4 g/mol. IUPAC name: (2R)-2-(4-fluoro-2-methylphenyl)piperidin-4-one;(2S)-2-hydroxy-2-phenylacetic acid. InChIKey: HQSMDORBTCGVLS-OLBMHGAYSA-N.
| Molecular formula | C20H22FNO4 |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | (2R)-2-(4-fluoro-2-methylphenyl)piperidin-4-one;(2S)-2-hydroxy-2-phenylacetic acid |
| InChIKey | HQSMDORBTCGVLS-OLBMHGAYSA-N |
| SMILES | CC1=C(C=CC(=C1)F)[C@H]2CC(=O)CCN2.C1=CC=C(C=C1)[C@@H](C(=O)O)O |
Computed by PubChem (NCBI)