CAS 414910-15-9 appears in our catalog under these names: Olaparib Impurity 9, tert–Butyl 4–(cyclopropanecarbonyl)piperazine–1–carboxylate, tert-Butyl 4-(cyclopropanecarbonyl)piperazine-1-carboxylate 95%, tert-Butyl 4-(cyclopropanecarbonyl)piperazine-1-carboxylate, 98%. Offered by: Chemat Brand, GLPBio, Ambeed, Fluorochem. Available pack sizes: on request, 1g, 5g, 100mg, 250mg, 10g, 25g, 100g.
Tert-butyl 4-(cyclopropanecarbonyl)piperazine-1-carboxylate (CAS 414910-15-9) is a chemical compound with the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. IUPAC name: tert-butyl 4-(cyclopropanecarbonyl)piperazine-1-carboxylate. InChIKey: IREXWNMKXDFMFW-UHFFFAOYSA-N.
| Molecular formula | C13H22N2O3 |
|---|---|
| Molecular weight | 254.33 g/mol |
| IUPAC name | tert-butyl 4-(cyclopropanecarbonyl)piperazine-1-carboxylate |
| InChIKey | IREXWNMKXDFMFW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C(=O)C2CC2 |
Computed by PubChem (NCBI)