CAS 4151-27-3 is the registry number for Butane-1,4-diylbis(diphenylphosphine oxide), 97%. Offered by: Chemat Brand. Available pack sizes: on request.
[4-diphenylphosphorylbutyl(phenyl)phosphoryl]benzene (CAS 4151-27-3) is a chemical compound with the molecular formula C28H28O2P2 and a molecular weight of 458.5 g/mol. IUPAC name: [4-diphenylphosphorylbutyl(phenyl)phosphoryl]benzene. InChIKey: NTBPLEQUXWWASM-UHFFFAOYSA-N.
| Molecular formula | C28H28O2P2 |
|---|---|
| Molecular weight | 458.5 g/mol |
| IUPAC name | [4-diphenylphosphorylbutyl(phenyl)phosphoryl]benzene |
| InChIKey | NTBPLEQUXWWASM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(=O)(CCCCP(=O)(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)