CAS 41530-90-9 appears in our catalog under these names: Ent-kaurane-2α,6α,16β-triol, 2,6,16-Kauranetriol. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
(1S,4S,9R,10S,13R,14S)-5,5,9,14-tetramethyltetracyclo[11.2.1.01,10.04,9]hexadecane-3,7,14-triol (CAS 41530-90-9) is a chemical compound with the molecular formula C20H34O3 and a molecular weight of 322.5 g/mol. IUPAC name: (1S,4S,9R,10S,13R,14S)-5,5,9,14-tetramethyltetracyclo[11.2.1.01,10.04,9]hexadecane-3,7,14-triol. InChIKey: MGTDZPRNONHJLG-QMVVIZBCSA-N.
| Molecular formula | C20H34O3 |
|---|---|
| Molecular weight | 322.5 g/mol |
| IUPAC name | (1S,4S,9R,10S,13R,14S)-5,5,9,14-tetramethyltetracyclo[11.2.1.01,10.04,9]hexadecane-3,7,14-triol |
| InChIKey | MGTDZPRNONHJLG-QMVVIZBCSA-N |
| SMILES | C[C@]12CC(CC([C@@H]1C(C[C@@]34[C@@H]2CC[C@H](C3)[C@@](C4)(C)O)O)(C)C)O |
Computed by PubChem (NCBI)