CAS 41545-56-6 is the registry number for 1,2,3,4,6-Penta-O-benzoyl-b-D-galactopyranose. Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g.
[(2R,3S,4S,5R,6S)-3,4,5,6-tetrabenzoyloxyoxan-2-yl]methyl benzoate (CAS 41545-56-6) is a chemical compound with the molecular formula C41H32O11 and a molecular weight of 700.7 g/mol. IUPAC name: [(2R,3S,4S,5R,6S)-3,4,5,6-tetrabenzoyloxyoxan-2-yl]methyl benzoate. InChIKey: JJNMLNFZFGSWQR-FDPJKMPCSA-N.
| Molecular formula | C41H32O11 |
|---|---|
| Molecular weight | 700.7 g/mol |
| IUPAC name | [(2R,3S,4S,5R,6S)-3,4,5,6-tetrabenzoyloxyoxan-2-yl]methyl benzoate |
| InChIKey | JJNMLNFZFGSWQR-FDPJKMPCSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC[C@@H]2[C@@H]([C@@H]([C@H]([C@@H](O2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5)OC(=O)C6=CC=CC=C6 |
Computed by PubChem (NCBI)