CAS 41552-82-3 appears in our catalog under these names: N6-Cyclopentyladenosine, 95%, N6-Cyclopentyladenosine, N6–Cyclopentyladenosine, N6-Cyclopentyladenosine/ 99.84% (existing batch purity), N6-Cyclopentyladenosine 99%. Offered by: Combi-blocks, TRC, GLPBio, TargetMol, Biosynth. Available pack sizes: 100mg, 250mg, 500mg, 1mg, 10mg, 5mg, 50mg, 25mg.
(2R,3R,4S,5R)-2-[6-(cyclopentylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (CAS 41552-82-3) is a chemical compound with the molecular formula C15H21N5O4 and a molecular weight of 335.36 g/mol. IUPAC name: (2R,3R,4S,5R)-2-[6-(cyclopentylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: SQMWSBKSHWARHU-SDBHATRESA-N.
| Molecular formula | C15H21N5O4 |
|---|---|
| Molecular weight | 335.36 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-[6-(cyclopentylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | SQMWSBKSHWARHU-SDBHATRESA-N |
| SMILES | C1CCC(C1)NC2=C3C(=NC=N2)N(C=N3)[C@H]4[C@@H]([C@@H]([C@H](O4)CO)O)O |
Computed by PubChem (NCBI)