Products 415694-16-5

CAS 415694-16-5 is the registry number for [Imino(3-nitrophenyl)methyl]azanyl 4-fluorobenzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

[(Z)-[amino-(3-nitrophenyl)methylidene]amino] 4-fluorobenzoate (CAS 415694-16-5) is a chemical compound with the molecular formula C14H10FN3O4 and a molecular weight of 303.24 g/mol. IUPAC name: [(Z)-[amino-(3-nitrophenyl)methylidene]amino] 4-fluorobenzoate. InChIKey: YTNIODYVNHTETN-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10FN3O4
Molecular weight303.24 g/mol
IUPAC name[(Z)-[amino-(3-nitrophenyl)methylidene]amino] 4-fluorobenzoate
InChIKeyYTNIODYVNHTETN-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)[N+](=O)[O-])/C(=N/OC(=O)C2=CC=C(C=C2)F)/N

Computed by PubChem (NCBI)