Products 415724-85-5
CAS 415724-85-5 is the registry number for Poricoic acid H. Offered by: MedChemExpress. Available pack sizes: Get quote.
Poricoic acid H is a secondary alcohol, a dicarboxylic acid and a tricyclic triterpenoid. It has a role as a fungal metabolite.
Source: ChEBI
| Molecular formula | C31H48O5 |
|---|---|
| Molecular weight | 500.7 g/mol |
| IUPAC name | (2R)-2-[(2R,3R,3aR,6S,7S,9bR)-6-(2-carboxyethyl)-2-hydroxy-3a,6,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,4,5,7,8,9-octahydrocyclopenta[a]naphthalen-3-yl]-6-methyl-5-methylideneheptanoic acid |
| InChIKey | GKXXWKRLARTIQL-SMFZDKLCSA-N |
| SMILES | CC(C)C(=C)CC[C@H]([C@H]1[C@@H](C[C@@]2([C@@]1(CCC3=C2CC[C@H]([C@]3(C)CCC(=O)O)C(=C)C)C)C)O)C(=O)O |
Computed by PubChem (NCBI)