CAS 41579-49-1 appears in our catalog under these names: Phenylmethanaminium tetrafluoroborate, 98%, Poly((9,9-dioctylfluorenyl-2,7-diyl)-alt-(9-hexyl-3,6-carbazole)). Offered by: AmBeed, Lumtec. Available pack sizes: 500g, On request.
Benzylazanium tetrafluoroborate (CAS 41579-49-1) is a chemical compound with the molecular formula C7H10BF4N and a molecular weight of 194.97 g/mol. IUPAC name: benzylazanium tetrafluoroborate. InChIKey: KSCNMENXBJDTJR-UHFFFAOYSA-O.
| Molecular formula | C7H10BF4N |
|---|---|
| Molecular weight | 194.97 g/mol |
| IUPAC name | benzylazanium tetrafluoroborate |
| InChIKey | KSCNMENXBJDTJR-UHFFFAOYSA-O |
| SMILES | [B-](F)(F)(F)F.C1=CC=C(C=C1)C[NH3+] |
Computed by PubChem (NCBI)