CAS 41609-06-7 is the registry number for CX4338. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(benzylamino)-4,4-dimethyl-6-oxo-N-phenylcyclohexene-1-carbothioamide (CAS 41609-06-7) is a chemical compound with the molecular formula C22H24N2OS and a molecular weight of 364.5 g/mol. IUPAC name: 2-(benzylamino)-4,4-dimethyl-6-oxo-N-phenylcyclohexene-1-carbothioamide. InChIKey: AESCWMGFNWXKFR-UHFFFAOYSA-N.
| Molecular formula | C22H24N2OS |
|---|---|
| Molecular weight | 364.5 g/mol |
| IUPAC name | 2-(benzylamino)-4,4-dimethyl-6-oxo-N-phenylcyclohexene-1-carbothioamide |
| InChIKey | AESCWMGFNWXKFR-UHFFFAOYSA-N |
| SMILES | CC1(CC(=C(C(=O)C1)C(=S)NC2=CC=CC=C2)NCC3=CC=CC=C3)C |
Computed by PubChem (NCBI)