CAS 41635-83-0 appears in our catalog under these names: Flurbiprofen Impurity 59, Flurbiprofen Impurity 20. Offered by: Chemat Brand. Available pack sizes: on request.
2-[3-fluoro-4-(4-methoxyphenyl)phenyl]propanoic acid (CAS 41635-83-0) is a chemical compound with the molecular formula C16H15FO3 and a molecular weight of 274.29 g/mol. IUPAC name: 2-[3-fluoro-4-(4-methoxyphenyl)phenyl]propanoic acid. InChIKey: ADNQRQZIGOHTSZ-UHFFFAOYSA-N.
| Molecular formula | C16H15FO3 |
|---|---|
| Molecular weight | 274.29 g/mol |
| IUPAC name | 2-[3-fluoro-4-(4-methoxyphenyl)phenyl]propanoic acid |
| InChIKey | ADNQRQZIGOHTSZ-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1)C2=CC=C(C=C2)OC)F)C(=O)O |
Computed by PubChem (NCBI)