CAS 41642-51-7 appears in our catalog under these names: Disperse blue 165, 95%, Disperse blue 165. Offered by: Combi-blocks, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 1kg, 100g, 250g, Get quote.
N-[2-[(2,6-dicyano-4-nitrophenyl)diazenyl]-5-(diethylamino)phenyl]acetamide (CAS 41642-51-7) is a chemical compound with the molecular formula C20H19N7O3 and a molecular weight of 405.4 g/mol. IUPAC name: N-[2-[(2,6-dicyano-4-nitrophenyl)diazenyl]-5-(diethylamino)phenyl]acetamide. InChIKey: LEGWLJGBFZBZSC-UHFFFAOYSA-N.
| Molecular formula | C20H19N7O3 |
|---|---|
| Molecular weight | 405.4 g/mol |
| IUPAC name | N-[2-[(2,6-dicyano-4-nitrophenyl)diazenyl]-5-(diethylamino)phenyl]acetamide |
| InChIKey | LEGWLJGBFZBZSC-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC(=C(C=C1)N=NC2=C(C=C(C=C2C#N)[N+](=O)[O-])C#N)NC(=O)C |
Computed by PubChem (NCBI)