Products 4165-62-2
CAS 4165-62-2 appears in our catalog under these names: Phenol D5, >95% (GC), Phenol-d5, >95% (GC), Phenol D5 (2,3,4,5,6 D5), Phenol D5 (2,3,4,5,6 D5) 100 µg/mL in Acetone, Phenol D5 (2,3,4,5,6 D5) 100 µg/mL in Methanol. Offered by: TRC, Dr. Ehrenstorfer, CDN, Sigma-Aldrich. Available pack sizes: 100mg, 1g, 5g, 1ml.
2,3,4,5,6-pentadeuteriophenol (CAS 4165-62-2) is a chemical compound with the molecular formula C6H6O and a molecular weight of 99.14 g/mol. IUPAC name: 2,3,4,5,6-pentadeuteriophenol. InChIKey: ISWSIDIOOBJBQZ-RALIUCGRSA-N.
| Molecular formula | C6H6O |
|---|---|
| Molecular weight | 99.14 g/mol |
| IUPAC name | 2,3,4,5,6-pentadeuteriophenol |
| InChIKey | ISWSIDIOOBJBQZ-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])O)[2H])[2H] |
Computed by PubChem (NCBI)