Products 4166-68-1
CAS 4166-68-1 appears in our catalog under these names: 1-Methylimidazole-d3-1, 1-Methylimidazole-d3 (ring-d3), 1-Methylimidazole-d3 (ring-d3), 98 atom % D, min 98% Chemical Purity. Offered by: MedChemExpress, TRC, CDN. Available pack sizes: 10 mg, 50 mg, 5 mg, 10mg, 50mg, 5mg, 0,5g, 0,25g.
2,4,5-trideuterio-1-methylimidazole (CAS 4166-68-1) is a chemical compound with the molecular formula C4H6N2 and a molecular weight of 85.12 g/mol. IUPAC name: 2,4,5-trideuterio-1-methylimidazole. InChIKey: MCTWTZJPVLRJOU-NRUYWUNFSA-N.
| Molecular formula | C4H6N2 |
|---|---|
| Molecular weight | 85.12 g/mol |
| IUPAC name | 2,4,5-trideuterio-1-methylimidazole |
| InChIKey | MCTWTZJPVLRJOU-NRUYWUNFSA-N |
| SMILES | [2H]C1=C(N(C(=N1)[2H])C)[2H] |
Computed by PubChem (NCBI)