CAS 41666-76-6 is the registry number for Malonato-1,3-propylenediamineplatinum(II), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Platinum(2+);propane-1,3-diamine;propanedioate (CAS 41666-76-6) is a chemical compound with the molecular formula C6H12N2O4Pt and a molecular weight of 371.25 g/mol. IUPAC name: platinum(2+);propane-1,3-diamine;propanedioate. InChIKey: QRJPFVNWJZYFDQ-UHFFFAOYSA-L.
| Molecular formula | C6H12N2O4Pt |
|---|---|
| Molecular weight | 371.25 g/mol |
| IUPAC name | platinum(2+);propane-1,3-diamine;propanedioate |
| InChIKey | QRJPFVNWJZYFDQ-UHFFFAOYSA-L |
| SMILES | C(CN)CN.C(C(=O)[O-])C(=O)[O-].[Pt+2] |
Computed by PubChem (NCBI)