Products 416867-97-5
CAS 416867-97-5 is the registry number for 1-(1-methyl-4-piperidinyl)-4-(4-nitrophenyl)piperazine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(1-methylpiperidin-4-yl)-4-(4-nitrophenyl)piperazine (CAS 416867-97-5) is a chemical compound with the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. IUPAC name: 1-(1-methylpiperidin-4-yl)-4-(4-nitrophenyl)piperazine. InChIKey: RLINILWAXFKMDS-UHFFFAOYSA-N.
| Molecular formula | C16H24N4O2 |
|---|---|
| Molecular weight | 304.39 g/mol |
| IUPAC name | 1-(1-methylpiperidin-4-yl)-4-(4-nitrophenyl)piperazine |
| InChIKey | RLINILWAXFKMDS-UHFFFAOYSA-N |
| SMILES | CN1CCC(CC1)N2CCN(CC2)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)