CAS 41713-37-5 appears in our catalog under these names: 3-Chlorophenylhydrazine sulfate, 95%, 3–Chlorophenylhydrazine Sulfate, 3-Chlorophenylhydrazine sulphate. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 25g, 1g, 5g, 50g, 100g.
(3-chlorophenyl)hydrazine;sulfuric acid (CAS 41713-37-5) is a chemical compound with the molecular formula C6H9ClN2O4S and a molecular weight of 240.67 g/mol. IUPAC name: (3-chlorophenyl)hydrazine;sulfuric acid. InChIKey: ZQMWFTLJZQAIHV-UHFFFAOYSA-N.
| Molecular formula | C6H9ClN2O4S |
|---|---|
| Molecular weight | 240.67 g/mol |
| IUPAC name | (3-chlorophenyl)hydrazine;sulfuric acid |
| InChIKey | ZQMWFTLJZQAIHV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)NN.OS(=O)(=O)O |
Computed by PubChem (NCBI)