CAS 4174-83-8 appears in our catalog under these names: Olopatadine Impurity 10 HBr, (3-(Methylamino)propyl)triphenylphosphonium bromide hydrobromide, 98%, (3-(Methylamino)propyl)triphenylphosphonium Bromide Hydrobromide, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 2,5g, 250mg.
3-(methylamino)propyl-triphenylphosphanium;bromide;hydrobromide (CAS 4174-83-8) is a chemical compound with the molecular formula C22H26Br2NP and a molecular weight of 495.2 g/mol. IUPAC name: 3-(methylamino)propyl-triphenylphosphanium;bromide;hydrobromide. InChIKey: KTZXQICNJXRYEI-UHFFFAOYSA-M.
| Molecular formula | C22H26Br2NP |
|---|---|
| Molecular weight | 495.2 g/mol |
| IUPAC name | 3-(methylamino)propyl-triphenylphosphanium;bromide;hydrobromide |
| InChIKey | KTZXQICNJXRYEI-UHFFFAOYSA-M |
| SMILES | CNCCC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.Br.[Br-] |
Computed by PubChem (NCBI)