CAS 4174-84-9 is the registry number for Olopatadine Impurity 11 HBr. Offered by: Chemat Brand. Available pack sizes: on request.
3-aminopropyl(triphenyl)phosphanium;bromide;hydrobromide (CAS 4174-84-9) is a chemical compound with the molecular formula C21H24Br2NP and a molecular weight of 481.2 g/mol. IUPAC name: 3-aminopropyl(triphenyl)phosphanium;bromide;hydrobromide. InChIKey: LFYXVSMAWADPSX-UHFFFAOYSA-M.
| Molecular formula | C21H24Br2NP |
|---|---|
| Molecular weight | 481.2 g/mol |
| IUPAC name | 3-aminopropyl(triphenyl)phosphanium;bromide;hydrobromide |
| InChIKey | LFYXVSMAWADPSX-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)[P+](CCCN)(C2=CC=CC=C2)C3=CC=CC=C3.Br.[Br-] |
Computed by PubChem (NCBI)