CAS 41740-17-4 appears in our catalog under these names: 6–Amino–2–phenylpyrimidin–4–ol, 6-Amino-2-phenylpyrimidin-4-ol, 95%, 6-Amino-2-phenylpyrimidin-4(3h)-one, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
4-amino-2-phenyl-1H-pyrimidin-6-one (CAS 41740-17-4) is a chemical compound with the molecular formula C10H9N3O and a molecular weight of 187.20 g/mol. IUPAC name: 4-amino-2-phenyl-1H-pyrimidin-6-one. InChIKey: PLBAPESPVBOCDW-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O |
|---|---|
| Molecular weight | 187.20 g/mol |
| IUPAC name | 4-amino-2-phenyl-1H-pyrimidin-6-one |
| InChIKey | PLBAPESPVBOCDW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CC(=O)N2)N |
Computed by PubChem (NCBI)