Products 41753-34-8

CAS 41753-34-8 is the registry number for 4-Chloro-2-picoline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 100g, 5g.

Structural formula: {0} (CAS {1})

4-chloro-2-methylpyridine;hydrochloride (CAS 41753-34-8) is a chemical compound with the molecular formula C6H7Cl2N and a molecular weight of 164.03 g/mol. IUPAC name: 4-chloro-2-methylpyridine;hydrochloride. InChIKey: GEFCQVXTSKQUPS-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7Cl2N
Molecular weight164.03 g/mol
IUPAC name4-chloro-2-methylpyridine;hydrochloride
InChIKeyGEFCQVXTSKQUPS-UHFFFAOYSA-N
SMILESCC1=NC=CC(=C1)Cl.Cl

Computed by PubChem (NCBI)