CAS 41754-10-3 is the registry number for Bis(N-isopropylsalicylideneiminato)nickel(II), 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
Nickel(2+);bis(2-(propan-2-yliminomethyl)phenolate) (CAS 41754-10-3) is a chemical compound with the molecular formula C20H24N2NiO2 and a molecular weight of 383.1 g/mol. IUPAC name: nickel(2+);bis(2-(propan-2-yliminomethyl)phenolate). InChIKey: SAYSBVLDFNIBSK-UHFFFAOYSA-L.
| Molecular formula | C20H24N2NiO2 |
|---|---|
| Molecular weight | 383.1 g/mol |
| IUPAC name | nickel(2+);bis(2-(propan-2-yliminomethyl)phenolate) |
| InChIKey | SAYSBVLDFNIBSK-UHFFFAOYSA-L |
| SMILES | CC(C)N=CC1=CC=CC=C1[O-].CC(C)N=CC1=CC=CC=C1[O-].[Ni+2] |
Computed by PubChem (NCBI)