CAS 417719-45-0 appears in our catalog under these names: Lenvatinib Impurity 33, Lenvatinib Impurity 53. Offered by: Chemat Brand. Available pack sizes: on request.
4-[3-chloro-4-(methylcarbamoylamino)phenoxy]-7-methoxyquinoline-6-carboxamide (CAS 417719-45-0) is a chemical compound with the molecular formula C19H17ClN4O4 and a molecular weight of 400.8 g/mol. IUPAC name: 4-[3-chloro-4-(methylcarbamoylamino)phenoxy]-7-methoxyquinoline-6-carboxamide. InChIKey: OOYBBISIVFMANP-UHFFFAOYSA-N.
| Molecular formula | C19H17ClN4O4 |
|---|---|
| Molecular weight | 400.8 g/mol |
| IUPAC name | 4-[3-chloro-4-(methylcarbamoylamino)phenoxy]-7-methoxyquinoline-6-carboxamide |
| InChIKey | OOYBBISIVFMANP-UHFFFAOYSA-N |
| SMILES | CNC(=O)NC1=C(C=C(C=C1)OC2=C3C=C(C(=CC3=NC=C2)OC)C(=O)N)Cl |
Computed by PubChem (NCBI)