CAS 417719-47-2 is the registry number for Lenvatinib Impurity 172. Offered by: Chemat Brand. Available pack sizes: on request.
4-[3-chloro-4-(propylcarbamoylamino)phenoxy]-7-methoxyquinoline-6-carboxamide (CAS 417719-47-2) is a chemical compound with the molecular formula C21H21ClN4O4 and a molecular weight of 428.9 g/mol. IUPAC name: 4-[3-chloro-4-(propylcarbamoylamino)phenoxy]-7-methoxyquinoline-6-carboxamide. InChIKey: ZXIGKCZIBDLPQC-UHFFFAOYSA-N.
| Molecular formula | C21H21ClN4O4 |
|---|---|
| Molecular weight | 428.9 g/mol |
| IUPAC name | 4-[3-chloro-4-(propylcarbamoylamino)phenoxy]-7-methoxyquinoline-6-carboxamide |
| InChIKey | ZXIGKCZIBDLPQC-UHFFFAOYSA-N |
| SMILES | CCCNC(=O)NC1=C(C=C(C=C1)OC2=C3C=C(C(=CC3=NC=C2)OC)C(=O)N)Cl |
Computed by PubChem (NCBI)