CAS 41785-81-3 appears in our catalog under these names: 2-tert-Butyl-3,3-dimethylbutanoic acid, 95%, 2-tert-Butyl-3,3-dimethylbutanoic acid, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
2-tert-butyl-3,3-dimethylbutanoic acid (CAS 41785-81-3) is a chemical compound with the molecular formula C10H20O2 and a molecular weight of 172.26 g/mol. IUPAC name: 2-tert-butyl-3,3-dimethylbutanoic acid. InChIKey: CSUSKPNFQZZRGX-UHFFFAOYSA-N.
| Molecular formula | C10H20O2 |
|---|---|
| Molecular weight | 172.26 g/mol |
| IUPAC name | 2-tert-butyl-3,3-dimethylbutanoic acid |
| InChIKey | CSUSKPNFQZZRGX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C(=O)O)C(C)(C)C |
Computed by PubChem (NCBI)