CAS 41796-13-8 is the registry number for 2,7-Dimethyl-4H-chromen-4-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2,7-dimethylchromen-4-one (CAS 41796-13-8) is a chemical compound with the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. IUPAC name: 2,7-dimethylchromen-4-one. InChIKey: ZPFCSSUWRXOPPB-UHFFFAOYSA-N.
| Molecular formula | C11H10O2 |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 2,7-dimethylchromen-4-one |
| InChIKey | ZPFCSSUWRXOPPB-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=O)C=C(O2)C |
Computed by PubChem (NCBI)