CAS 41804-96-0 appears in our catalog under these names: AH 7921 Hydrochloride, AH-7921.HCl, AH-7921.HCl, 1mg/ml in Methanol (as free base). Offered by: TRC, Lipomed. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 100mg, 1ml.
3,4-dichloro-N-[[1-(dimethylamino)cyclohexyl]methyl]benzamide;hydrochloride (CAS 41804-96-0) is a chemical compound with the molecular formula C16H23Cl3N2O and a molecular weight of 365.7 g/mol. IUPAC name: 3,4-dichloro-N-[[1-(dimethylamino)cyclohexyl]methyl]benzamide;hydrochloride. InChIKey: GYMKEMDHKUDSBK-UHFFFAOYSA-N.
| Molecular formula | C16H23Cl3N2O |
|---|---|
| Molecular weight | 365.7 g/mol |
| IUPAC name | 3,4-dichloro-N-[[1-(dimethylamino)cyclohexyl]methyl]benzamide;hydrochloride |
| InChIKey | GYMKEMDHKUDSBK-UHFFFAOYSA-N |
| SMILES | CN(C)C1(CCCCC1)CNC(=O)C2=CC(=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)