CAS 4181-20-8 appears in our catalog under these names: Tris(4–iodophenyl)amine, Tris(4-iodophenyl)amine, >97.0%(GC), Tris(4-iodophenyl)amine 97%, Tris(4-iodophenyl)amine, 97%, 97%, Tris(4-iodophenyl)amine, 97%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g, 10g, 500g.
4-iodo-N,N-bis(4-iodophenyl)aniline (CAS 4181-20-8) is a chemical compound with the molecular formula C18H12I3N and a molecular weight of 623.0 g/mol. IUPAC name: 4-iodo-N,N-bis(4-iodophenyl)aniline. InChIKey: AQGZDWJFOYXGAA-UHFFFAOYSA-N.
| Molecular formula | C18H12I3N |
|---|---|
| Molecular weight | 623.0 g/mol |
| IUPAC name | 4-iodo-N,N-bis(4-iodophenyl)aniline |
| InChIKey | AQGZDWJFOYXGAA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N(C2=CC=C(C=C2)I)C3=CC=C(C=C3)I)I |
Computed by PubChem (NCBI)