CAS 41830-81-3 appears in our catalog under these names: Oxazine 4 perchlorate, 95%, 3,7–Bis(ethylamino)–2,8–dimethylphenoxazin–5–ium perchlorate, Oxazine 4 Perchlorate, >98.0%(HPLC)(N), Oxazine 4 Perchlorate, 3,7-Bis(ethylamino)-2,8-dimethylphenoxazin-5-ium perchlorate, ≥98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 200mg, 100mg.
Ethyl-[7-(ethylamino)-2,8-dimethylphenoxazin-3-ylidene]azanium perchlorate (CAS 41830-81-3) is a chemical compound with the molecular formula C18H22ClN3O5 and a molecular weight of 395.8 g/mol. IUPAC name: ethyl-[7-(ethylamino)-2,8-dimethylphenoxazin-3-ylidene]azanium perchlorate. InChIKey: YDTINNWJPMAKSP-UHFFFAOYSA-N.
| Molecular formula | C18H22ClN3O5 |
|---|---|
| Molecular weight | 395.8 g/mol |
| IUPAC name | ethyl-[7-(ethylamino)-2,8-dimethylphenoxazin-3-ylidene]azanium perchlorate |
| InChIKey | YDTINNWJPMAKSP-UHFFFAOYSA-N |
| SMILES | CCNC1=CC2=C(C=C1C)N=C3C=C(C(=[NH+]CC)C=C3O2)C.[O-]Cl(=O)(=O)=O |
Computed by PubChem (NCBI)