Products 41833-82-3
CAS 41833-82-3 is the registry number for Beta-Morpholino-Alpha-(3,4-dimethoxy-5-bromobenzyl)acrylonitrile. Offered by: TRC. Available pack sizes: 500mg, 50mg.
(Z)-2-[(3-bromo-4,5-dimethoxyphenyl)methyl]-3-morpholin-4-ylprop-2-enenitrile (CAS 41833-82-3) is a chemical compound with the molecular formula C16H19BrN2O3 and a molecular weight of 367.24 g/mol. IUPAC name: (Z)-2-[(3-bromo-4,5-dimethoxyphenyl)methyl]-3-morpholin-4-ylprop-2-enenitrile. InChIKey: YOHQDSDVEUJYIW-QBFSEMIESA-N.
| Molecular formula | C16H19BrN2O3 |
|---|---|
| Molecular weight | 367.24 g/mol |
| IUPAC name | (Z)-2-[(3-bromo-4,5-dimethoxyphenyl)methyl]-3-morpholin-4-ylprop-2-enenitrile |
| InChIKey | YOHQDSDVEUJYIW-QBFSEMIESA-N |
| SMILES | COC1=C(C(=CC(=C1)C/C(=C/N2CCOCC2)/C#N)Br)OC |
Computed by PubChem (NCBI)