CAS 41859-58-9 appears in our catalog under these names: Bezafibrate EP Impurity D, Bezafibrate Impurity 4(Bezafibrate EP Impurity D), Bezafibrate Ethyl Ester, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
Ethyl 2-[4-[2-[(4-chlorobenzoyl)amino]ethyl]phenoxy]-2-methylpropanoate (CAS 41859-58-9) is a chemical compound with the molecular formula C21H24ClNO4 and a molecular weight of 389.9 g/mol. IUPAC name: ethyl 2-[4-[2-[(4-chlorobenzoyl)amino]ethyl]phenoxy]-2-methylpropanoate. InChIKey: KSGYUJBREQWZHK-UHFFFAOYSA-N.
| Molecular formula | C21H24ClNO4 |
|---|---|
| Molecular weight | 389.9 g/mol |
| IUPAC name | ethyl 2-[4-[2-[(4-chlorobenzoyl)amino]ethyl]phenoxy]-2-methylpropanoate |
| InChIKey | KSGYUJBREQWZHK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C)OC1=CC=C(C=C1)CCNC(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)