CAS 41866-12-0 is the registry number for 4,4-Dimethyl-cyclohexanone-2,2,6,6-d4. Offered by: TRC. Available pack sizes: 5mg.
2,2,6,6-tetradeuterio-4,4-dimethylcyclohexan-1-one (CAS 41866-12-0) is a chemical compound with the molecular formula C8H14O and a molecular weight of 130.22 g/mol. IUPAC name: 2,2,6,6-tetradeuterio-4,4-dimethylcyclohexan-1-one. InChIKey: PXQMSTLNSHMSJB-KHORGVISSA-N.
| Molecular formula | C8H14O |
|---|---|
| Molecular weight | 130.22 g/mol |
| IUPAC name | 2,2,6,6-tetradeuterio-4,4-dimethylcyclohexan-1-one |
| InChIKey | PXQMSTLNSHMSJB-KHORGVISSA-N |
| SMILES | [2H]C1(CC(CC(C1=O)([2H])[2H])(C)C)[2H] |
Computed by PubChem (NCBI)